CAS 2092001-08-4 is the registry number for 5-bromo-2-(2-methylpropoxy)-3-(trifluoromethyl)pyridine, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-bromo-2-(2-methylpropoxy)-3-(trifluoromethyl)pyridine (CAS 2092001-08-4) is a chemical compound with the molecular formula C10H11BrF3NO and a molecular weight of 298.10 g/mol. IUPAC name: 5-bromo-2-(2-methylpropoxy)-3-(trifluoromethyl)pyridine. InChIKey: NLCRFENGLLLARZ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF3NO |
|---|---|
| Molecular weight | 298.10 g/mol |
| IUPAC name | 5-bromo-2-(2-methylpropoxy)-3-(trifluoromethyl)pyridine |
| InChIKey | NLCRFENGLLLARZ-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=C(C=C(C=N1)Br)C(F)(F)F |
Computed by PubChem (NCBI)