CAS 866135-77-5 is the registry number for 3-([(2-Bromophenyl)methyl]amino)-1,1,1-trifluoropropan-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-[(2-bromophenyl)methylamino]-1,1,1-trifluoropropan-2-ol (CAS 866135-77-5) is a chemical compound with the molecular formula C10H11BrF3NO and a molecular weight of 298.10 g/mol. IUPAC name: 3-[(2-bromophenyl)methylamino]-1,1,1-trifluoropropan-2-ol. InChIKey: IDVWSFPENHRCEV-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF3NO |
|---|---|
| Molecular weight | 298.10 g/mol |
| IUPAC name | 3-[(2-bromophenyl)methylamino]-1,1,1-trifluoropropan-2-ol |
| InChIKey | IDVWSFPENHRCEV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNCC(C(F)(F)F)O)Br |
Computed by PubChem (NCBI)