CAS 2167722-27-0 is the registry number for 1-[2-Bromo-5-(2,2,2-trifluoroethoxy)phenyl]ethylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[2-bromo-5-(2,2,2-trifluoroethoxy)phenyl]ethanamine (CAS 2167722-27-0) is a chemical compound with the molecular formula C10H11BrF3NO and a molecular weight of 298.10 g/mol. IUPAC name: 1-[2-bromo-5-(2,2,2-trifluoroethoxy)phenyl]ethanamine. InChIKey: LDKLBAIETXFXFN-UHFFFAOYSA-N.
| Molecular formula | C10H11BrF3NO |
|---|---|
| Molecular weight | 298.10 g/mol |
| IUPAC name | 1-[2-bromo-5-(2,2,2-trifluoroethoxy)phenyl]ethanamine |
| InChIKey | LDKLBAIETXFXFN-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=CC(=C1)OCC(F)(F)F)Br)N |
Computed by PubChem (NCBI)