CAS 1212879-41-8 is the registry number for (R)-6-(1-Amino-2,2,2-trifluoroethyl)pyridin-2-amine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
6-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-2-amine (CAS 1212879-41-8) is a chemical compound with the molecular formula C7H8F3N3 and a molecular weight of 191.15 g/mol. IUPAC name: 6-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-2-amine. InChIKey: STEWLSAHFHOAMI-ZCFIWIBFSA-N.
| Molecular formula | C7H8F3N3 |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | 6-[(1R)-1-amino-2,2,2-trifluoroethyl]pyridin-2-amine |
| InChIKey | STEWLSAHFHOAMI-ZCFIWIBFSA-N |
| SMILES | C1=CC(=NC(=C1)N)[C@H](C(F)(F)F)N |
Computed by PubChem (NCBI)