CAS 2658557-21-0 is the registry number for 6-(Trifluoromethyl)benzene-1,2,4-triamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethyl)benzene-1,2,4-triamine (CAS 2658557-21-0) is a chemical compound with the molecular formula C7H8F3N3 and a molecular weight of 191.15 g/mol. IUPAC name: 6-(trifluoromethyl)benzene-1,2,4-triamine. InChIKey: OFWSWLGWYLENJX-UHFFFAOYSA-N.
| Molecular formula | C7H8F3N3 |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | 6-(trifluoromethyl)benzene-1,2,4-triamine |
| InChIKey | OFWSWLGWYLENJX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)N)N)N |
Computed by PubChem (NCBI)