CAS 1270380-55-6 is the registry number for 5-(1-Amino-2,2,2-trifluoroethyl)pyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(1-amino-2,2,2-trifluoroethyl)pyridin-2-amine (CAS 1270380-55-6) is a chemical compound with the molecular formula C7H8F3N3 and a molecular weight of 191.15 g/mol. IUPAC name: 5-(1-amino-2,2,2-trifluoroethyl)pyridin-2-amine. InChIKey: NRHOFVQDYXKWBT-UHFFFAOYSA-N.
| Molecular formula | C7H8F3N3 |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | 5-(1-amino-2,2,2-trifluoroethyl)pyridin-2-amine |
| InChIKey | NRHOFVQDYXKWBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(C(F)(F)F)N)N |
Computed by PubChem (NCBI)