CAS 22123-09-7 appears in our catalog under these names: 6-Methyl-4-(trifluoromethyl)pyrid-2-yl hydrazine, 95%, 2-Hydrazinyl-6-methyl-4-(trifluoromethyl)pyridine, 97%, 6-Methyl-4-(trifluoromethyl)pyrid-2-yl hydrazine. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
[6-methyl-4-(trifluoromethyl)-2-pyridinyl]hydrazine (CAS 22123-09-7) is a chemical compound with the molecular formula C7H8F3N3 and a molecular weight of 191.15 g/mol. IUPAC name: [6-methyl-4-(trifluoromethyl)-2-pyridinyl]hydrazine. InChIKey: MBJJCIYNRRPIGV-UHFFFAOYSA-N.
| Molecular formula | C7H8F3N3 |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | [6-methyl-4-(trifluoromethyl)-2-pyridinyl]hydrazine |
| InChIKey | MBJJCIYNRRPIGV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=N1)NN)C(F)(F)F |
Computed by PubChem (NCBI)