Products 1212970-07-4
CAS 1212970-07-4 is the registry number for (R)-2-(3-Chloro-5-(trifluoromethyl)phenyl)piperidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-[3-chloro-5-(trifluoromethyl)phenyl]piperidine (CAS 1212970-07-4) is a chemical compound with the molecular formula C12H13ClF3N and a molecular weight of 263.68 g/mol. IUPAC name: (2R)-2-[3-chloro-5-(trifluoromethyl)phenyl]piperidine. InChIKey: SHXFFRQBIYLOHR-LLVKDONJSA-N.
| Molecular formula | C12H13ClF3N |
|---|---|
| Molecular weight | 263.68 g/mol |
| IUPAC name | (2R)-2-[3-chloro-5-(trifluoromethyl)phenyl]piperidine |
| InChIKey | SHXFFRQBIYLOHR-LLVKDONJSA-N |
| SMILES | C1CCN[C@H](C1)C2=CC(=CC(=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)