CAS 66504-80-1 is the registry number for 1-(3-(Trifluoromethyl)phenyl)-3-azabicyclo(3.1.0)hexane Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
1-[3-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane;hydrochloride (CAS 66504-80-1) is a chemical compound with the molecular formula C12H13ClF3N and a molecular weight of 263.68 g/mol. IUPAC name: 1-[3-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane;hydrochloride. InChIKey: AWROSGAAGPSJOW-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF3N |
|---|---|
| Molecular weight | 263.68 g/mol |
| IUPAC name | 1-[3-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane;hydrochloride |
| InChIKey | AWROSGAAGPSJOW-UHFFFAOYSA-N |
| SMILES | C1C2C1(CNC2)C3=CC(=CC=C3)C(F)(F)F.Cl |
Computed by PubChem (NCBI)