Products 1823259-46-6
CAS 1823259-46-6 is the registry number for 6-(4-(Trifluoromethyl)phenyl)-3-azabicyclo(3.1.0)hexane hydrochloride. Offered by: Biosynth. Available pack sizes: 5mg, 10mg.
6-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane;hydrochloride (CAS 1823259-46-6) is a chemical compound with the molecular formula C12H13ClF3N and a molecular weight of 263.68 g/mol. IUPAC name: 6-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane;hydrochloride. InChIKey: JMKRWIJPTFRLRU-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF3N |
|---|---|
| Molecular weight | 263.68 g/mol |
| IUPAC name | 6-[4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexane;hydrochloride |
| InChIKey | JMKRWIJPTFRLRU-UHFFFAOYSA-N |
| SMILES | C1C2C(C2C3=CC=C(C=C3)C(F)(F)F)CN1.Cl |
Computed by PubChem (NCBI)