Products 230615-01-7
CAS 230615-01-7 appears in our catalog under these names: (Rac)–CP–601927 hydrochloride, (Rac)-CP-601927 (hydrochloride), 99%, 99%, (Rac)-CP-601927 (hydrochloride), 99.72%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 1mg, 50 mg, 10 mg, 100 mg, 25 mg.
4-(trifluoromethyl)-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene;hydrochloride (CAS 230615-01-7) is a chemical compound with the molecular formula C12H13ClF3N and a molecular weight of 263.68 g/mol. IUPAC name: 4-(trifluoromethyl)-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene;hydrochloride. InChIKey: ZHTWFWUVFSXTNF-UHFFFAOYSA-N.
| Molecular formula | C12H13ClF3N |
|---|---|
| Molecular weight | 263.68 g/mol |
| IUPAC name | 4-(trifluoromethyl)-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene;hydrochloride |
| InChIKey | ZHTWFWUVFSXTNF-UHFFFAOYSA-N |
| SMILES | C1C2CNCC1C3=C2C=CC(=C3)C(F)(F)F.Cl |
Computed by PubChem (NCBI)