Products 1212993-64-0
CAS 1212993-64-0 is the registry number for (S)-5,7-Difluorochroman-4-amine. Offered by: TRC. Available pack sizes: 50mg.
(4S)-5,7-difluoro-3,4-dihydro-2H-chromen-4-amine (CAS 1212993-64-0) is a chemical compound with the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. IUPAC name: (4S)-5,7-difluoro-3,4-dihydro-2H-chromen-4-amine. InChIKey: ZJGYMNXLPZADME-ZETCQYMHSA-N.
| Molecular formula | C9H9F2NO |
|---|---|
| Molecular weight | 185.17 g/mol |
| IUPAC name | (4S)-5,7-difluoro-3,4-dihydro-2H-chromen-4-amine |
| InChIKey | ZJGYMNXLPZADME-ZETCQYMHSA-N |
| SMILES | C1COC2=C([C@H]1N)C(=CC(=C2)F)F |
Computed by PubChem (NCBI)