Products 886762-87-4
CAS 886762-87-4 appears in our catalog under these names: 5,7-Difluorochroman-4-amine, 95%, 5,7-Difluorochroman-4-amine 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g.
5,7-difluoro-3,4-dihydro-2H-chromen-4-amine (CAS 886762-87-4) is a chemical compound with the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. IUPAC name: 5,7-difluoro-3,4-dihydro-2H-chromen-4-amine. InChIKey: ZJGYMNXLPZADME-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO |
|---|---|
| Molecular weight | 185.17 g/mol |
| IUPAC name | 5,7-difluoro-3,4-dihydro-2H-chromen-4-amine |
| InChIKey | ZJGYMNXLPZADME-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C(=CC(=C2)F)F |
Computed by PubChem (NCBI)