CAS 81652-57-5 is the registry number for 2,6-Difluoro-N,N-dimethylbenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,6-difluoro-N,N-dimethylbenzamide (CAS 81652-57-5) is a chemical compound with the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. IUPAC name: 2,6-difluoro-N,N-dimethylbenzamide. InChIKey: ZJVFBWLHHOXGRO-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO |
|---|---|
| Molecular weight | 185.17 g/mol |
| IUPAC name | 2,6-difluoro-N,N-dimethylbenzamide |
| InChIKey | ZJVFBWLHHOXGRO-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=CC=C1F)F |
Computed by PubChem (NCBI)