CAS 1250280-48-8 is the registry number for 2,3-Difluoro-n,n-dimethylbenzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g, 25g.
2,3-difluoro-N,N-dimethylbenzamide (CAS 1250280-48-8) is a chemical compound with the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. IUPAC name: 2,3-difluoro-N,N-dimethylbenzamide. InChIKey: OKKUWTBMQNBGKH-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO |
|---|---|
| Molecular weight | 185.17 g/mol |
| IUPAC name | 2,3-difluoro-N,N-dimethylbenzamide |
| InChIKey | OKKUWTBMQNBGKH-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C(=CC=C1)F)F |
Computed by PubChem (NCBI)