Products 1212995-93-1
CAS 1212995-93-1 is the registry number for (S)-1-(3-Chloro-5-fluorophenyl)propan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(3-chloro-5-fluorophenyl)propan-1-amine (CAS 1212995-93-1) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: (1S)-1-(3-chloro-5-fluorophenyl)propan-1-amine. InChIKey: BXGVCIZTMHDUOG-VIFPVBQESA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | (1S)-1-(3-chloro-5-fluorophenyl)propan-1-amine |
| InChIKey | BXGVCIZTMHDUOG-VIFPVBQESA-N |
| SMILES | CC[C@@H](C1=CC(=CC(=C1)Cl)F)N |
Computed by PubChem (NCBI)