CAS 1213051-27-4 appears in our catalog under these names: Boc-2,3-dimethyl-d-phenylalanine, 95%, Boc–2,3–Dimethyl–D–phenylalanine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
(2R)-3-(2,3-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1213051-27-4) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: (2R)-3-(2,3-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: UWEUVXSPNWWCBP-CYBMUJFWSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | (2R)-3-(2,3-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | UWEUVXSPNWWCBP-CYBMUJFWSA-N |
| SMILES | CC1=C(C(=CC=C1)C[C@H](C(=O)O)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)