Products 849440-32-0
CAS 849440-32-0 is the registry number for Boc-2,3-Dimethyl-L-phenylalanine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(2S)-3-(2,3-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 849440-32-0) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: (2S)-3-(2,3-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: UWEUVXSPNWWCBP-ZDUSSCGKSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | (2S)-3-(2,3-dimethylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | UWEUVXSPNWWCBP-ZDUSSCGKSA-N |
| SMILES | CC1=C(C(=CC=C1)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)