Products 1213056-85-9
CAS 1213056-85-9 is the registry number for (S)-1-(3-Chloro-4-(trifluoromethoxy)phenyl)pentan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]pentan-1-amine (CAS 1213056-85-9) is a chemical compound with the molecular formula C12H15ClF3NO and a molecular weight of 281.70 g/mol. IUPAC name: (1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]pentan-1-amine. InChIKey: FBSCCJYSPYCPFX-JTQLQIEISA-N.
| Molecular formula | C12H15ClF3NO |
|---|---|
| Molecular weight | 281.70 g/mol |
| IUPAC name | (1S)-1-[3-chloro-4-(trifluoromethoxy)phenyl]pentan-1-amine |
| InChIKey | FBSCCJYSPYCPFX-JTQLQIEISA-N |
| SMILES | CCCC[C@@H](C1=CC(=C(C=C1)OC(F)(F)F)Cl)N |
Computed by PubChem (NCBI)