CAS 1389375-78-3 is the registry number for (R)-1-(3-Chloro-4-(trifluoromethoxy)phenyl)-2,2-dimethylpropan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2,2-dimethylpropan-1-amine (CAS 1389375-78-3) is a chemical compound with the molecular formula C12H15ClF3NO and a molecular weight of 281.70 g/mol. IUPAC name: (1R)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2,2-dimethylpropan-1-amine. InChIKey: UVDODQNBQBELCK-JTQLQIEISA-N.
| Molecular formula | C12H15ClF3NO |
|---|---|
| Molecular weight | 281.70 g/mol |
| IUPAC name | (1R)-1-[3-chloro-4-(trifluoromethoxy)phenyl]-2,2-dimethylpropan-1-amine |
| InChIKey | UVDODQNBQBELCK-JTQLQIEISA-N |
| SMILES | CC(C)(C)[C@H](C1=CC(=C(C=C1)OC(F)(F)F)Cl)N |
Computed by PubChem (NCBI)