CAS 1380300-52-6 appears in our catalog under these names: 4-(3-(Trifluoromethyl)phenyl)tetrahydro-2H-pyran-4-amine hydrochloride, 97%, 4-(3-(Trifluoromethyl)phenyl)oxan-4-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
4-[3-(trifluoromethyl)phenyl]oxan-4-amine;hydrochloride (CAS 1380300-52-6) is a chemical compound with the molecular formula C12H15ClF3NO and a molecular weight of 281.70 g/mol. IUPAC name: 4-[3-(trifluoromethyl)phenyl]oxan-4-amine;hydrochloride. InChIKey: JCRLMHIHKSMGAN-UHFFFAOYSA-N.
| Molecular formula | C12H15ClF3NO |
|---|---|
| Molecular weight | 281.70 g/mol |
| IUPAC name | 4-[3-(trifluoromethyl)phenyl]oxan-4-amine;hydrochloride |
| InChIKey | JCRLMHIHKSMGAN-UHFFFAOYSA-N |
| SMILES | C1COCCC1(C2=CC(=CC=C2)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)