CAS 1213087-68-3 is the registry number for (R)-1-(3-Chloro-4-fluorophenyl)pentan-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(3-chloro-4-fluorophenyl)pentan-1-amine (CAS 1213087-68-3) is a chemical compound with the molecular formula C11H15ClFN and a molecular weight of 215.69 g/mol. IUPAC name: (1R)-1-(3-chloro-4-fluorophenyl)pentan-1-amine. InChIKey: FSTXYJWNMCABRQ-LLVKDONJSA-N.
| Molecular formula | C11H15ClFN |
|---|---|
| Molecular weight | 215.69 g/mol |
| IUPAC name | (1R)-1-(3-chloro-4-fluorophenyl)pentan-1-amine |
| InChIKey | FSTXYJWNMCABRQ-LLVKDONJSA-N |
| SMILES | CCCC[C@H](C1=CC(=C(C=C1)F)Cl)N |
Computed by PubChem (NCBI)