Products 1213100-58-3
CAS 1213100-58-3 is the registry number for (S)-(3,5-Bis(trifluoromethyl)phenyl)(cyclopropyl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(S)-[3,5-bis(trifluoromethyl)phenyl]-cyclopropylmethanamine (CAS 1213100-58-3) is a chemical compound with the molecular formula C12H11F6N and a molecular weight of 283.21 g/mol. IUPAC name: (S)-[3,5-bis(trifluoromethyl)phenyl]-cyclopropylmethanamine. InChIKey: HGSIUNSWLDLVIN-JTQLQIEISA-N.
| Molecular formula | C12H11F6N |
|---|---|
| Molecular weight | 283.21 g/mol |
| IUPAC name | (S)-[3,5-bis(trifluoromethyl)phenyl]-cyclopropylmethanamine |
| InChIKey | HGSIUNSWLDLVIN-JTQLQIEISA-N |
| SMILES | C1CC1[C@@H](C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)N |
Computed by PubChem (NCBI)