CAS 1259771-95-3 is the registry number for (R)-5,7-bis(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-5,7-bis(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 1259771-95-3) is a chemical compound with the molecular formula C12H11F6N and a molecular weight of 283.21 g/mol. IUPAC name: (1R)-5,7-bis(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: ZTNOXXFRYIJVMK-SNVBAGLBSA-N.
| Molecular formula | C12H11F6N |
|---|---|
| Molecular weight | 283.21 g/mol |
| IUPAC name | (1R)-5,7-bis(trifluoromethyl)-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | ZTNOXXFRYIJVMK-SNVBAGLBSA-N |
| SMILES | C1C[C@H](C2=C(C1)C(=CC(=C2)C(F)(F)F)C(F)(F)F)N |
Computed by PubChem (NCBI)