CAS 1213591-33-3 is the registry number for (S)-2-(3,5-Bis(trifluoromethyl)phenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[3,5-bis(trifluoromethyl)phenyl]pyrrolidine (CAS 1213591-33-3) is a chemical compound with the molecular formula C12H11F6N and a molecular weight of 283.21 g/mol. IUPAC name: (2S)-2-[3,5-bis(trifluoromethyl)phenyl]pyrrolidine. InChIKey: GLIXFTDOFVBSQP-JTQLQIEISA-N.
| Molecular formula | C12H11F6N |
|---|---|
| Molecular weight | 283.21 g/mol |
| IUPAC name | (2S)-2-[3,5-bis(trifluoromethyl)phenyl]pyrrolidine |
| InChIKey | GLIXFTDOFVBSQP-JTQLQIEISA-N |
| SMILES | C1C[C@H](NC1)C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)