CAS 921630-38-8 is the registry number for N-([2,5-Bis(trifluoromethyl)phenyl]methyl)cyclopropanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-[[2,5-bis(trifluoromethyl)phenyl]methyl]cyclopropanamine (CAS 921630-38-8) is a chemical compound with the molecular formula C12H11F6N and a molecular weight of 283.21 g/mol. IUPAC name: N-[[2,5-bis(trifluoromethyl)phenyl]methyl]cyclopropanamine. InChIKey: HKYORPIUYJTOFG-UHFFFAOYSA-N.
| Molecular formula | C12H11F6N |
|---|---|
| Molecular weight | 283.21 g/mol |
| IUPAC name | N-[[2,5-bis(trifluoromethyl)phenyl]methyl]cyclopropanamine |
| InChIKey | HKYORPIUYJTOFG-UHFFFAOYSA-N |
| SMILES | C1CC1NCC2=C(C=CC(=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)