CAS 1213102-81-8 is the registry number for (R)-2-AMINO-2-(4-BROMOPHENYL)PROPANOIC ACID, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(2R)-2-amino-2-(4-bromophenyl)propanoic acid (CAS 1213102-81-8) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: (2R)-2-amino-2-(4-bromophenyl)propanoic acid. InChIKey: LCJMKSWXOYWTFZ-SECBINFHSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-bromophenyl)propanoic acid |
| InChIKey | LCJMKSWXOYWTFZ-SECBINFHSA-N |
| SMILES | C[C@@](C1=CC=C(C=C1)Br)(C(=O)O)N |
Computed by PubChem (NCBI)