CAS 72408-57-2 appears in our catalog under these names: 2–Amino–2–(4–bromophenyl)propanoic acid, 2-Amino-2-(4-bromophenyl)propanoic acid, 2-Amino-2-(4-bromophenyl)propanoic acid, 95%. Offered by: GLPBio, Biosynth, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 50mg.
2-amino-2-(4-bromophenyl)propanoic acid (CAS 72408-57-2) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: 2-amino-2-(4-bromophenyl)propanoic acid. InChIKey: LCJMKSWXOYWTFZ-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | 2-amino-2-(4-bromophenyl)propanoic acid |
| InChIKey | LCJMKSWXOYWTFZ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Br)(C(=O)O)N |
Computed by PubChem (NCBI)