CAS 1213125-10-0 is the registry number for (R)-2,3-Difluoro-5-(pyrrolidin-2-yl)phenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-difluoro-5-[(2R)-pyrrolidin-2-yl]phenol (CAS 1213125-10-0) is a chemical compound with the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. IUPAC name: 2,3-difluoro-5-[(2R)-pyrrolidin-2-yl]phenol. InChIKey: GUBQWSYHBYIGNB-MRVPVSSYSA-N.
| Molecular formula | C10H11F2NO |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 2,3-difluoro-5-[(2R)-pyrrolidin-2-yl]phenol |
| InChIKey | GUBQWSYHBYIGNB-MRVPVSSYSA-N |
| SMILES | C1C[C@@H](NC1)C2=CC(=C(C(=C2)F)F)O |
Computed by PubChem (NCBI)