CAS 1902254-13-0 is the registry number for (4R)-2-(Difluoromethyl)-4-phenyl-1,3-oxazolidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4R)-2-(difluoromethyl)-4-phenyl-1,3-oxazolidine (CAS 1902254-13-0) is a chemical compound with the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. IUPAC name: (4R)-2-(difluoromethyl)-4-phenyl-1,3-oxazolidine. InChIKey: STKOFIQOIXGNCK-PEHGTWAWSA-N.
| Molecular formula | C10H11F2NO |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | (4R)-2-(difluoromethyl)-4-phenyl-1,3-oxazolidine |
| InChIKey | STKOFIQOIXGNCK-PEHGTWAWSA-N |
| SMILES | C1[C@H](NC(O1)C(F)F)C2=CC=CC=C2 |
Computed by PubChem (NCBI)