CAS 954264-62-1 appears in our catalog under these names: 6-(Difluoromethoxy)-1,2,3,4-tetrahydroquinoline, 95%, 6-(Difluoromethoxy)-1,2,3,4-tetrahydroquinoline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
6-(difluoromethoxy)-1,2,3,4-tetrahydroquinoline (CAS 954264-62-1) is a chemical compound with the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. IUPAC name: 6-(difluoromethoxy)-1,2,3,4-tetrahydroquinoline. InChIKey: DZDFJYGJGKTWJD-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 6-(difluoromethoxy)-1,2,3,4-tetrahydroquinoline |
| InChIKey | DZDFJYGJGKTWJD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)OC(F)F)NC1 |
Computed by PubChem (NCBI)