CAS 1935323-99-1 is the registry number for 3-(2,6-Difluoro-4-methylphenyl)azetidin-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,6-difluoro-4-methylphenyl)azetidin-3-ol (CAS 1935323-99-1) is a chemical compound with the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. IUPAC name: 3-(2,6-difluoro-4-methylphenyl)azetidin-3-ol. InChIKey: YORGECRURHMDEO-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 3-(2,6-difluoro-4-methylphenyl)azetidin-3-ol |
| InChIKey | YORGECRURHMDEO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)F)C2(CNC2)O)F |
Computed by PubChem (NCBI)