CAS 1213143-66-8 is the registry number for (R)-3,5-Difluoro-4-(pyrrolidin-2-yl)aniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-difluoro-4-[(2R)-pyrrolidin-2-yl]aniline (CAS 1213143-66-8) is a chemical compound with the molecular formula C10H12F2N2 and a molecular weight of 198.21 g/mol. IUPAC name: 3,5-difluoro-4-[(2R)-pyrrolidin-2-yl]aniline. InChIKey: YQWRXDDATQGWCM-SECBINFHSA-N.
| Molecular formula | C10H12F2N2 |
|---|---|
| Molecular weight | 198.21 g/mol |
| IUPAC name | 3,5-difluoro-4-[(2R)-pyrrolidin-2-yl]aniline |
| InChIKey | YQWRXDDATQGWCM-SECBINFHSA-N |
| SMILES | C1C[C@@H](NC1)C2=C(C=C(C=C2F)N)F |
Computed by PubChem (NCBI)