Products 1484193-33-0
CAS 1484193-33-0 appears in our catalog under these names: 2-(2,2-Difluoroethyl)-2,3-dihydro-1H-isoindol-5-amine, 95%, 2-(2,2-Difluoroethyl)-2,3-dihydro-1H-isoindol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(2,2-difluoroethyl)-1,3-dihydroisoindol-5-amine (CAS 1484193-33-0) is a chemical compound with the molecular formula C10H12F2N2 and a molecular weight of 198.21 g/mol. IUPAC name: 2-(2,2-difluoroethyl)-1,3-dihydroisoindol-5-amine. InChIKey: RCLXLNAXPRBUBU-UHFFFAOYSA-N.
| Molecular formula | C10H12F2N2 |
|---|---|
| Molecular weight | 198.21 g/mol |
| IUPAC name | 2-(2,2-difluoroethyl)-1,3-dihydroisoindol-5-amine |
| InChIKey | RCLXLNAXPRBUBU-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1CC(F)F)C=C(C=C2)N |
Computed by PubChem (NCBI)