CAS 1344145-39-6 is the registry number for Rel-((1s,3s)-3-fluoro-1-(3-fluoropyridin-2-yl)cyclobutyl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-fluoro-1-(3-fluoro-2-pyridinyl)cyclobutyl]methanamine (CAS 1344145-39-6) is a chemical compound with the molecular formula C10H12F2N2 and a molecular weight of 198.21 g/mol. IUPAC name: [3-fluoro-1-(3-fluoro-2-pyridinyl)cyclobutyl]methanamine. InChIKey: TYNMKBSYEUUDOM-UHFFFAOYSA-N.
| Molecular formula | C10H12F2N2 |
|---|---|
| Molecular weight | 198.21 g/mol |
| IUPAC name | [3-fluoro-1-(3-fluoro-2-pyridinyl)cyclobutyl]methanamine |
| InChIKey | TYNMKBSYEUUDOM-UHFFFAOYSA-N |
| SMILES | C1C(CC1(CN)C2=C(C=CC=N2)F)F |
Computed by PubChem (NCBI)