CAS 255893-57-3 is the registry number for 1-(3,4-Difluorophenyl)piperazine. Offered by: Biosynth. Available pack sizes: 1g, 0,5g, 5g.
1-(3,4-difluorophenyl)piperazine (CAS 255893-57-3) is a chemical compound with the molecular formula C10H12F2N2 and a molecular weight of 198.21 g/mol. IUPAC name: 1-(3,4-difluorophenyl)piperazine. InChIKey: VRVIKRZIQWEYFB-UHFFFAOYSA-N.
| Molecular formula | C10H12F2N2 |
|---|---|
| Molecular weight | 198.21 g/mol |
| IUPAC name | 1-(3,4-difluorophenyl)piperazine |
| InChIKey | VRVIKRZIQWEYFB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)