Products 1213170-99-0
CAS 1213170-99-0 appears in our catalog under these names: (R)-1-(6-Bromopyridin-2-yl)-2,2,2-trifluoroethan-1-amine, (R)-1-(6-Bromopyridin-2-yl)-2,2,2-trifluoroethan-1-amine, 95%. Offered by: Biosynth, Ambeed, BLDpharm. Available pack sizes: 1g, 0,5g, 2g, 5g, 250mg.
(1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethanamine (CAS 1213170-99-0) is a chemical compound with the molecular formula C7H6BrF3N2 and a molecular weight of 255.03 g/mol. IUPAC name: (1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethanamine. InChIKey: YCUATFYSPCIFSY-ZCFIWIBFSA-N.
| Molecular formula | C7H6BrF3N2 |
|---|---|
| Molecular weight | 255.03 g/mol |
| IUPAC name | (1R)-1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethanamine |
| InChIKey | YCUATFYSPCIFSY-ZCFIWIBFSA-N |
| SMILES | C1=CC(=NC(=C1)Br)[C@H](C(F)(F)F)N |
Computed by PubChem (NCBI)