CAS 1213373-00-2 is the registry number for (1R)-1-(3,5-Difluorophenyl)-2,2,2-trifluoroethylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(1R)-1-(3,5-difluorophenyl)-2,2,2-trifluoroethanamine (CAS 1213373-00-2) is a chemical compound with the molecular formula C8H6F5N and a molecular weight of 211.13 g/mol. IUPAC name: (1R)-1-(3,5-difluorophenyl)-2,2,2-trifluoroethanamine. InChIKey: ZGXAKNAMSFQOGQ-SSDOTTSWSA-N.
| Molecular formula | C8H6F5N |
|---|---|
| Molecular weight | 211.13 g/mol |
| IUPAC name | (1R)-1-(3,5-difluorophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | ZGXAKNAMSFQOGQ-SSDOTTSWSA-N |
| SMILES | C1=C(C=C(C=C1F)F)[C@H](C(F)(F)F)N |
Computed by PubChem (NCBI)