CAS 2386554-04-5 appears in our catalog under these names: 2-(Difluoromethyl)-4-(trifluoromethyl)aniline, 95%, 2-(Difluoromethyl)-4-(trifluoromethyl)benzenamine, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg.
2-(difluoromethyl)-4-(trifluoromethyl)aniline (CAS 2386554-04-5) is a chemical compound with the molecular formula C8H6F5N and a molecular weight of 211.13 g/mol. IUPAC name: 2-(difluoromethyl)-4-(trifluoromethyl)aniline. InChIKey: LYRKERISZMRTIH-UHFFFAOYSA-N.
| Molecular formula | C8H6F5N |
|---|---|
| Molecular weight | 211.13 g/mol |
| IUPAC name | 2-(difluoromethyl)-4-(trifluoromethyl)aniline |
| InChIKey | LYRKERISZMRTIH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)F)N |
Computed by PubChem (NCBI)