Products 581813-21-0
CAS 581813-21-0 is the registry number for 2,3-Difluoro-4-(trifluoromethyl)benzylamine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
[2,3-difluoro-4-(trifluoromethyl)phenyl]methanamine (CAS 581813-21-0) is a chemical compound with the molecular formula C8H6F5N and a molecular weight of 211.13 g/mol. IUPAC name: [2,3-difluoro-4-(trifluoromethyl)phenyl]methanamine. InChIKey: PEKCLTCAWNBFME-UHFFFAOYSA-N.
| Molecular formula | C8H6F5N |
|---|---|
| Molecular weight | 211.13 g/mol |
| IUPAC name | [2,3-difluoro-4-(trifluoromethyl)phenyl]methanamine |
| InChIKey | PEKCLTCAWNBFME-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1CN)F)F)C(F)(F)F |
Computed by PubChem (NCBI)