CAS 1213481-25-4 is the registry number for (R)-1-(2,5-Difluorophenyl)-2,2,2-trifluoroethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(2,5-difluorophenyl)-2,2,2-trifluoroethanamine (CAS 1213481-25-4) is a chemical compound with the molecular formula C8H6F5N and a molecular weight of 211.13 g/mol. IUPAC name: (1R)-1-(2,5-difluorophenyl)-2,2,2-trifluoroethanamine. InChIKey: ZLLPOBHFCDKHRN-SSDOTTSWSA-N.
| Molecular formula | C8H6F5N |
|---|---|
| Molecular weight | 211.13 g/mol |
| IUPAC name | (1R)-1-(2,5-difluorophenyl)-2,2,2-trifluoroethanamine |
| InChIKey | ZLLPOBHFCDKHRN-SSDOTTSWSA-N |
| SMILES | C1=CC(=C(C=C1F)[C@H](C(F)(F)F)N)F |
Computed by PubChem (NCBI)