CAS 1213451-21-8 is the registry number for (R)-4-Fluoro-2-(pyrrolidin-2-yl)phenol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-2-[(2R)-pyrrolidin-2-yl]phenol (CAS 1213451-21-8) is a chemical compound with the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. IUPAC name: 4-fluoro-2-[(2R)-pyrrolidin-2-yl]phenol. InChIKey: PIHKPXDJNMQHGB-SECBINFHSA-N.
| Molecular formula | C10H12FNO |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | 4-fluoro-2-[(2R)-pyrrolidin-2-yl]phenol |
| InChIKey | PIHKPXDJNMQHGB-SECBINFHSA-N |
| SMILES | C1C[C@@H](NC1)C2=C(C=CC(=C2)F)O |
Computed by PubChem (NCBI)