CAS 1213490-03-9 is the registry number for (S)-2-Amino-2-(2,3-dimethylphenyl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-2-(2,3-dimethylphenyl)acetic acid (CAS 1213490-03-9) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (2S)-2-amino-2-(2,3-dimethylphenyl)acetic acid. InChIKey: FLGHVLZZFJGYOP-VIFPVBQESA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (2S)-2-amino-2-(2,3-dimethylphenyl)acetic acid |
| InChIKey | FLGHVLZZFJGYOP-VIFPVBQESA-N |
| SMILES | CC1=C(C(=CC=C1)[C@@H](C(=O)O)N)C |
Computed by PubChem (NCBI)