Products 1213507-49-3
CAS 1213507-49-3 is the registry number for Methyl (R)-3-amino-3-(3,5-dimethoxyphenyl)propanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3R)-3-amino-3-(3,5-dimethoxyphenyl)propanoate (CAS 1213507-49-3) is a chemical compound with the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. IUPAC name: methyl (3R)-3-amino-3-(3,5-dimethoxyphenyl)propanoate. InChIKey: ILMPFVTZJSNUHY-LLVKDONJSA-N.
| Molecular formula | C12H17NO4 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | methyl (3R)-3-amino-3-(3,5-dimethoxyphenyl)propanoate |
| InChIKey | ILMPFVTZJSNUHY-LLVKDONJSA-N |
| SMILES | COC1=CC(=CC(=C1)[C@@H](CC(=O)OC)N)OC |
Computed by PubChem (NCBI)