Products 1213543-02-2
CAS 1213543-02-2 is the registry number for (S)-Cyclopropyl(2,4-difluorophenyl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(S)-cyclopropyl-(2,4-difluorophenyl)methanamine (CAS 1213543-02-2) is a chemical compound with the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. IUPAC name: (S)-cyclopropyl-(2,4-difluorophenyl)methanamine. InChIKey: UNSUUWJOOWONDC-JTQLQIEISA-N.
| Molecular formula | C10H11F2N |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | (S)-cyclopropyl-(2,4-difluorophenyl)methanamine |
| InChIKey | UNSUUWJOOWONDC-JTQLQIEISA-N |
| SMILES | C1CC1[C@@H](C2=C(C=C(C=C2)F)F)N |
Computed by PubChem (NCBI)