CAS 536695-22-4 is the registry number for Cyclopropyl(2,4-difluorophenyl)methanamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Cyclopropyl-(2,4-difluorophenyl)methanamine (CAS 536695-22-4) is a chemical compound with the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. IUPAC name: cyclopropyl-(2,4-difluorophenyl)methanamine. InChIKey: UNSUUWJOOWONDC-UHFFFAOYSA-N.
| Molecular formula | C10H11F2N |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | cyclopropyl-(2,4-difluorophenyl)methanamine |
| InChIKey | UNSUUWJOOWONDC-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=C(C=C(C=C2)F)F)N |
Computed by PubChem (NCBI)