CAS 1213552-86-3 is the registry number for (S)-2-(3,5-Dichlorophenyl)pyrrolidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(3,5-dichlorophenyl)pyrrolidine (CAS 1213552-86-3) is a chemical compound with the molecular formula C10H11Cl2N and a molecular weight of 216.10 g/mol. IUPAC name: (2S)-2-(3,5-dichlorophenyl)pyrrolidine. InChIKey: RGJUGOHYPAYSDI-JTQLQIEISA-N.
| Molecular formula | C10H11Cl2N |
|---|---|
| Molecular weight | 216.10 g/mol |
| IUPAC name | (2S)-2-(3,5-dichlorophenyl)pyrrolidine |
| InChIKey | RGJUGOHYPAYSDI-JTQLQIEISA-N |
| SMILES | C1C[C@H](NC1)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)