CAS 887344-13-0 appears in our catalog under these names: 2-(3,5-Dichlorophenyl)pyrrolidine, 95%, 2-(3,5-Dichlorophenyl)Pyrrolidine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
2-(3,5-dichlorophenyl)pyrrolidine (CAS 887344-13-0) is a chemical compound with the molecular formula C10H11Cl2N and a molecular weight of 216.10 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)pyrrolidine. InChIKey: RGJUGOHYPAYSDI-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2N |
|---|---|
| Molecular weight | 216.10 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)pyrrolidine |
| InChIKey | RGJUGOHYPAYSDI-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)