CAS 1213596-00-9 is the registry number for Methyl (2R)-2-amino-2-(3-bromophenyl)acetate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Methyl (2R)-2-amino-2-(3-bromophenyl)acetate (CAS 1213596-00-9) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: methyl (2R)-2-amino-2-(3-bromophenyl)acetate. InChIKey: UMYOROLJNUQQTA-MRVPVSSYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | methyl (2R)-2-amino-2-(3-bromophenyl)acetate |
| InChIKey | UMYOROLJNUQQTA-MRVPVSSYSA-N |
| SMILES | COC(=O)[C@@H](C1=CC(=CC=C1)Br)N |
Computed by PubChem (NCBI)