CAS 1213631-93-6 is the registry number for (R)-1-(3,4-Dichlorophenyl)butan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(3,4-dichlorophenyl)butan-1-amine (CAS 1213631-93-6) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: (1R)-1-(3,4-dichlorophenyl)butan-1-amine. InChIKey: CJQHLZJQVQONFN-SNVBAGLBSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | (1R)-1-(3,4-dichlorophenyl)butan-1-amine |
| InChIKey | CJQHLZJQVQONFN-SNVBAGLBSA-N |
| SMILES | CCC[C@H](C1=CC(=C(C=C1)Cl)Cl)N |
Computed by PubChem (NCBI)